C35H20ClF3N8 — CID 155371082
7-[5-[5-chloro-2-methyl-4-[3-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-pyridinyl]phenyl]-2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 155371082) has the molecular formula C35H20ClF3N8 and a molecular weight of 645.05 g/mol. Its IUPAC name is 7-[5-[5-chloro-2-methyl-4-[3-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-pyridinyl]phenyl]-2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 7-[5-[5-chloro-2-methyl-4-[3-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-pyridinyl]phenyl]-2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 155371082 |
| Molecular Formula | C35H20ClF3N8 |
| Molecular Weight | 645.05 g/mol |
| Exact Mass | 644.15 |
| IUPAC Name | 7-[5-[5-chloro-2-methyl-4-[3-([1,2,4]triazolo[1,5-a]pyridin-7-yl)-2-pyridinyl]phenyl]-2-(3,4,5-trifluorophenyl)-3-pyridinyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cc(-c2ncccc2-c2ccn3ncnc3c2)c(Cl)cc1-c1cnc(-c2cc(F)c(F)c(F)c2)c(-c2ccn3ncnc3c2)c1 |
| InChI | InChI=1S/C35H20ClF3N8/c1-19-9-27(35-24(3-2-6-40-35)20-4-7-46-31(13-20)42-17-44-46)28(36)15-25(19)23-10-26(21-5-8-47-32(14-21)43-18-45-47)34(41-16-23)22-11-29(37)33(39)30(38)12-22/h2-18H,1H3 |
| InChIKey | VLDAWKGKMNUQPN-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 86.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.05 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|