C24H26 — CID 15537109
(1S,2S,4R,7R)-3,3,8,8-tetramethyl-1,5-diphenyltricyclo[5.1.0.02,4]oct-5-ene (PubChem CID 15537109) has the molecular formula C24H26 and a molecular weight of 314.47 g/mol. Its IUPAC name is (1S,2S,4R,7R)-3,3,8,8-tetramethyl-1,5-diphenyltricyclo[5.1.0.02,4]oct-5-ene.
| Compound Name | (1S,2S,4R,7R)-3,3,8,8-tetramethyl-1,5-diphenyltricyclo[5.1.0.02,4]oct-5-ene |
|---|---|
| PubChem CID | 15537109 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (1S,2S,4R,7R)-3,3,8,8-tetramethyl-1,5-diphenyltricyclo[5.1.0.02,4]oct-5-ene |
| SMILES | CC1(C)[C@@H]2C(c3ccccc3)=C[C@@H]3C(C)(C)[C@@]3(c3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C24H26/c1-22(2)20-18(16-11-7-5-8-12-16)15-19-23(3,4)24(19,21(20)22)17-13-9-6-10-14-17/h5-15,19-21H,1-4H3/t19-,20-,21+,24-/m1/s1 |
| InChIKey | RNMLCEKGWYKIDE-IUBSTNSRSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |