C18H26N2O4 — CID 155371268
methyl (E)-4-[[(3S)-1-[(2E,4Z)-2-methylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]but-2-enoate (PubChem CID 155371268) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is methyl (E)-4-[[(3S)-1-[(2E,4Z)-2-methylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]but-2-enoate.
| Compound Name | methyl (E)-4-[[(3S)-1-[(2E,4Z)-2-methylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 155371268 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | methyl (E)-4-[[(3S)-1-[(2E,4Z)-2-methylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]but-2-enoate |
| SMILES | C/C=C\C=C(/C)C(=O)N1CCC[C@H](C(=O)NC/C=C/C(=O)OC)C1 |
| InChI | InChI=1S/C18H26N2O4/c1-4-5-8-14(2)18(23)20-12-7-9-15(13-20)17(22)19-11-6-10-16(21)24-3/h4-6,8,10,15H,7,9,11-13H2,1-3H3,(H,19,22)/b5-4-,10-6+,14-8+/t15-/m0/s1 |
| InChIKey | WRLAGMVFKXRMOI-BVJRBSHZSA-N |
| XLogP | 1.59 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|