C20H28N2O4 — CID 155371296
methyl (E)-5-[[(3S)-1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]pent-2-enoate (PubChem CID 155371296) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is methyl (E)-5-[[(3S)-1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]pent-2-enoate.
| Compound Name | methyl (E)-5-[[(3S)-1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]pent-2-enoate |
|---|---|
| PubChem CID | 155371296 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | methyl (E)-5-[[(3S)-1-[(2E,4Z)-2-ethenylhexa-2,4-dienoyl]piperidine-3-carbonyl]amino]pent-2-enoate |
| SMILES | C=C/C(=C\C=C/C)C(=O)N1CCC[C@H](C(=O)NCC/C=C/C(=O)OC)C1 |
| InChI | InChI=1S/C20H28N2O4/c1-4-6-10-16(5-2)20(25)22-14-9-11-17(15-22)19(24)21-13-8-7-12-18(23)26-3/h4-7,10,12,17H,2,8-9,11,13-15H2,1,3H3,(H,21,24)/b6-4-,12-7+,16-10+/t17-/m0/s1 |
| InChIKey | RTRIIIBTBBIWMV-AWVFKZRFSA-N |
| XLogP | 2.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|