C16H29N3O3S — CID 155371365
4-methylsulfanyl-8,12-di(propan-2-yl)-1,5,9-triazacyclododecane-2,6,10-trione (PubChem CID 155371365) has the molecular formula C16H29N3O3S and a molecular weight of 343.49 g/mol. Its IUPAC name is 4-methylsulfanyl-8,12-di(propan-2-yl)-1,5,9-triazacyclododecane-2,6,10-trione.
| Compound Name | 4-methylsulfanyl-8,12-di(propan-2-yl)-1,5,9-triazacyclododecane-2,6,10-trione |
|---|---|
| PubChem CID | 155371365 |
| Molecular Formula | C16H29N3O3S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | 4-methylsulfanyl-8,12-di(propan-2-yl)-1,5,9-triazacyclododecane-2,6,10-trione |
| SMILES | CSC1CC(=O)NC(C(C)C)CC(=O)NC(C(C)C)CC(=O)N1 |
| InChI | InChI=1S/C16H29N3O3S/c1-9(2)11-6-13(20)17-12(10(3)4)7-14(21)19-16(23-5)8-15(22)18-11/h9-12,16H,6-8H2,1-5H3,(H,17,20)(H,18,22)(H,19,21) |
| InChIKey | PDDMHFLEOWTLHH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |