About N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide
N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide (PubChem CID 155371480) has the molecular formula C13H26N4
and a molecular weight of 238.38 g/mol. Its IUPAC name is N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide.
Molecular Properties
| Compound Name | N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide |
| PubChem CID | 155371480 |
| Molecular Formula | C13H26N4 |
| Molecular Weight | 238.38 g/mol |
| Exact Mass | 238.22 |
| IUPAC Name | N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide |
| SMILES | C=C(/C=C/N(CNC)C(C)CC)N/C=N/CC |
| InChI | InChI=1S/C13H26N4/c1-6-13(4)17(11-14-5)9-8-12(3)16-10-15-7-2/h8-10,13-14H,3,6-7,11H2,1-2,4-5H3,(H,15,16)/b9-8+ |
| InChIKey | YUZCAOVXHOPYLA-CMDGGOBGSA-N |
| XLogP | 1.93 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide?
The IUPAC name of N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide (CID 155371480) is N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide.
What is the SMILES notation for N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide?
The canonical SMILES for N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide is C=C(/C=C/N(CNC)C(C)CC)N/C=N/CC.
What is the InChIKey of N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide?
The InChIKey is YUZCAOVXHOPYLA-CMDGGOBGSA-N. The full InChI is InChI=1S/C13H26N4/c1-6-13(4)17(11-14-5)9-8-12(3)16-10-15-7-2/h8-10,13-14H,3,6-7,11H2,1-2,4-5H3,(H,15,16)/b9-8+.
What are the key properties of N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide?
N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide has a molecular weight of 238.38 g/mol, XLogP of 1.93, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-4-[butan-2-yl(methylaminomethyl)amino]buta-1,3-dien-2-yl]-N'-ethylmethanimidamide is sourced from PubChem (CID 155371480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).