C17H26N2O — CID 155371491
N-[(2E,3Z)-2-ethylidene-5-piperidin-1-ylhexa-3,5-dienyl]-N-prop-1-en-2-ylformamide (PubChem CID 155371491) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is N-[(2E,3Z)-2-ethylidene-5-piperidin-1-ylhexa-3,5-dienyl]-N-prop-1-en-2-ylformamide.
| Compound Name | N-[(2E,3Z)-2-ethylidene-5-piperidin-1-ylhexa-3,5-dienyl]-N-prop-1-en-2-ylformamide |
|---|---|
| PubChem CID | 155371491 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | N-[(2E,3Z)-2-ethylidene-5-piperidin-1-ylhexa-3,5-dienyl]-N-prop-1-en-2-ylformamide |
| SMILES | C=C(C)N(C=O)CC(/C=C\C(=C)N1CCCCC1)=C/C |
| InChI | InChI=1S/C17H26N2O/c1-5-17(13-19(14-20)15(2)3)10-9-16(4)18-11-7-6-8-12-18/h5,9-10,14H,2,4,6-8,11-13H2,1,3H3/b10-9-,17-5+ |
| InChIKey | GBWYOVFYQLOJDW-SYSGVOERSA-N |
| XLogP | 3.48 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|