About (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane
(4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane (PubChem CID 155371528) has the molecular formula C10H18N2
and a molecular weight of 166.27 g/mol. Its IUPAC name is (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane.
Molecular Properties
| Compound Name | (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane |
| PubChem CID | 155371528 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane |
| SMILES | CC(C)=C/C=C1\CNCN[C@H]1C |
| InChI | InChI=1S/C10H18N2/c1-8(2)4-5-10-6-11-7-12-9(10)3/h4-5,9,11-12H,6-7H2,1-3H3/b10-5+/t9-/m0/s1 |
| InChIKey | OGOUAXJPUZIDDC-UMYFRRCYSA-N |
| XLogP | 1.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane?
The IUPAC name of (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane (CID 155371528) is (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane.
What is the SMILES notation for (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane?
The canonical SMILES for (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane is CC(C)=C/C=C1\CNCN[C@H]1C.
What is the InChIKey of (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane?
The InChIKey is OGOUAXJPUZIDDC-UMYFRRCYSA-N. The full InChI is InChI=1S/C10H18N2/c1-8(2)4-5-10-6-11-7-12-9(10)3/h4-5,9,11-12H,6-7H2,1-3H3/b10-5+/t9-/m0/s1.
What are the key properties of (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane?
(4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane has a molecular weight of 166.27 g/mol, XLogP of 1.42, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5E)-4-methyl-5-(3-methylbut-2-enylidene)-1,3-diazinane is sourced from PubChem (CID 155371528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).