C16H8F3N3O — CID 155371731
2-[3-cyano-4,5-dimethyl-5-(2,4,6-trifluorophenyl)furan-2-ylidene]propanedinitrile (PubChem CID 155371731) has the molecular formula C16H8F3N3O and a molecular weight of 315.25 g/mol. Its IUPAC name is 2-[3-cyano-4,5-dimethyl-5-(2,4,6-trifluorophenyl)furan-2-ylidene]propanedinitrile.
| Compound Name | 2-[3-cyano-4,5-dimethyl-5-(2,4,6-trifluorophenyl)furan-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 155371731 |
| Molecular Formula | C16H8F3N3O |
| Molecular Weight | 315.25 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-[3-cyano-4,5-dimethyl-5-(2,4,6-trifluorophenyl)furan-2-ylidene]propanedinitrile |
| SMILES | CC1=C(C#N)C(=C(C#N)C#N)OC1(C)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C16H8F3N3O/c1-8-11(7-22)15(9(5-20)6-21)23-16(8,2)14-12(18)3-10(17)4-13(14)19/h3-4H,1-2H3 |
| InChIKey | LRXGEWBYDVJBAX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.25 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|