About (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine
(3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine (PubChem CID 155371754) has the molecular formula C13H25NS
and a molecular weight of 227.42 g/mol. Its IUPAC name is (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine.
Molecular Properties
| Compound Name | (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine |
| PubChem CID | 155371754 |
| Molecular Formula | C13H25NS |
| Molecular Weight | 227.42 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine |
| SMILES | C=C/C=C(\CC(C)SCC)NCCCC |
| InChI | InChI=1S/C13H25NS/c1-5-8-10-14-13(9-6-2)11-12(4)15-7-3/h6,9,12,14H,2,5,7-8,10-11H2,1,3-4H3/b13-9+ |
| InChIKey | KFWXKZDPNUVKOP-UKTHLTGXSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine?
The IUPAC name of (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine (CID 155371754) is (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine.
What is the SMILES notation for (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine?
The canonical SMILES for (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine is C=C/C=C(\CC(C)SCC)NCCCC.
What is the InChIKey of (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine?
The InChIKey is KFWXKZDPNUVKOP-UKTHLTGXSA-N. The full InChI is InChI=1S/C13H25NS/c1-5-8-10-14-13(9-6-2)11-12(4)15-7-3/h6,9,12,14H,2,5,7-8,10-11H2,1,3-4H3/b13-9+.
What are the key properties of (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine?
(3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine has a molecular weight of 227.42 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-butyl-6-ethylsulfanylhepta-1,3-dien-4-amine is sourced from PubChem (CID 155371754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).