C18H25F2N — CID 155371817
(3Z,7E)-3,7-di(ethylidene)-1,1-difluoro-N-methyl-4,6,8-trimethylidenedecan-2-imine (PubChem CID 155371817) has the molecular formula C18H25F2N and a molecular weight of 293.40 g/mol. Its IUPAC name is (3Z,7E)-3,7-di(ethylidene)-1,1-difluoro-N-methyl-4,6,8-trimethylidenedecan-2-imine.
| Compound Name | (3Z,7E)-3,7-di(ethylidene)-1,1-difluoro-N-methyl-4,6,8-trimethylidenedecan-2-imine |
|---|---|
| PubChem CID | 155371817 |
| Molecular Formula | C18H25F2N |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (3Z,7E)-3,7-di(ethylidene)-1,1-difluoro-N-methyl-4,6,8-trimethylidenedecan-2-imine |
| SMILES | C=C(CC(=C)/C(=C/C)C(=C)CC)C(=C/C)/C(=N/C)C(F)F |
| InChI | InChI=1S/C18H25F2N/c1-8-12(4)15(9-2)13(5)11-14(6)16(10-3)17(21-7)18(19)20/h9-10,18H,4-6,8,11H2,1-3,7H3/b15-9+,16-10-,21-17- |
| InChIKey | UCYHGCHNNSLULA-INQNEMJOSA-N |
| XLogP | 5.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|