C17H27N5 — CID 155371879
2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-N,3-dimethyl-4-[(Z)-3-(methylamino)prop-2-enyl]-4H-pyrimidine-2,6-diamine (PubChem CID 155371879) has the molecular formula C17H27N5 and a molecular weight of 301.44 g/mol. Its IUPAC name is 2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-N,3-dimethyl-4-[(Z)-3-(methylamino)prop-2-enyl]-4H-pyrimidine-2,6-diamine.
| Compound Name | 2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-N,3-dimethyl-4-[(Z)-3-(methylamino)prop-2-enyl]-4H-pyrimidine-2,6-diamine |
|---|---|
| PubChem CID | 155371879 |
| Molecular Formula | C17H27N5 |
| Molecular Weight | 301.44 g/mol |
| Exact Mass | 301.23 |
| IUPAC Name | 2-N-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-6-N,3-dimethyl-4-[(Z)-3-(methylamino)prop-2-enyl]-4H-pyrimidine-2,6-diamine |
| SMILES | C=C/C=C(\C=C/C)NC1=NC(NC)=CC(C/C=C\NC)N1C |
| InChI | InChI=1S/C17H27N5/c1-6-9-14(10-7-2)20-17-21-16(19-4)13-15(22(17)5)11-8-12-18-3/h6-10,12-13,15,18-19H,1,11H2,2-5H3,(H,20,21)/b10-7-,12-8-,14-9+ |
| InChIKey | NRKODIPBBWRKMQ-WRJXCUOWSA-N |
| XLogP | 2.08 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.44 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|