C14H21N — CID 155372191
2-[(2S,3Z,5Z)-hepta-3,5-dien-2-yl]-3,6-dimethyl-2,3-dihydropyridine (PubChem CID 155372191) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-[(2S,3Z,5Z)-hepta-3,5-dien-2-yl]-3,6-dimethyl-2,3-dihydropyridine.
| Compound Name | 2-[(2S,3Z,5Z)-hepta-3,5-dien-2-yl]-3,6-dimethyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 155372191 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-[(2S,3Z,5Z)-hepta-3,5-dien-2-yl]-3,6-dimethyl-2,3-dihydropyridine |
| SMILES | C/C=C\C=C/[C@H](C)C1N=C(C)C=CC1C |
| InChI | InChI=1S/C14H21N/c1-5-6-7-8-11(2)14-12(3)9-10-13(4)15-14/h5-12,14H,1-4H3/b6-5-,8-7-/t11-,12?,14?/m0/s1 |
| InChIKey | URMXYCWRMYDWGD-ZNOLKSSLSA-N |
| XLogP | 3.79 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|