C24H35N3O — CID 155372390
(E)-3-[[(1Z)-3,4-dimethylpenta-1,3-dienyl]-methylamino]-2-ethyl-N-[4-[(Z)-1-(methylamino)prop-1-enyl]phenyl]but-2-enamide (PubChem CID 155372390) has the molecular formula C24H35N3O and a molecular weight of 381.56 g/mol. Its IUPAC name is (E)-3-[[(1Z)-3,4-dimethylpenta-1,3-dienyl]-methylamino]-2-ethyl-N-[4-[(Z)-1-(methylamino)prop-1-enyl]phenyl]but-2-enamide.
| Compound Name | (E)-3-[[(1Z)-3,4-dimethylpenta-1,3-dienyl]-methylamino]-2-ethyl-N-[4-[(Z)-1-(methylamino)prop-1-enyl]phenyl]but-2-enamide |
|---|---|
| PubChem CID | 155372390 |
| Molecular Formula | C24H35N3O |
| Molecular Weight | 381.56 g/mol |
| Exact Mass | 381.28 |
| IUPAC Name | (E)-3-[[(1Z)-3,4-dimethylpenta-1,3-dienyl]-methylamino]-2-ethyl-N-[4-[(Z)-1-(methylamino)prop-1-enyl]phenyl]but-2-enamide |
| SMILES | C/C=C(\NC)c1ccc(NC(=O)/C(CC)=C(\C)N(C)/C=C\C(C)=C(C)C)cc1 |
| InChI | InChI=1S/C24H35N3O/c1-9-22(19(6)27(8)16-15-18(5)17(3)4)24(28)26-21-13-11-20(12-14-21)23(10-2)25-7/h10-16,25H,9H2,1-8H3,(H,26,28)/b16-15-,22-19+,23-10- |
| InChIKey | BPRVTATYZZFLGT-MGGXRMBYSA-N |
| XLogP | 5.69 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|