About (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol
(1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol (PubChem CID 155372664) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol.
Molecular Properties
| Compound Name | (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol |
| PubChem CID | 155372664 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol |
| SMILES | CNCC(C)/C=C\C=C(/N)O |
| InChI | InChI=1S/C8H16N2O/c1-7(6-10-2)4-3-5-8(9)11/h3-5,7,10-11H,6,9H2,1-2H3/b4-3-,8-5+ |
| InChIKey | SQFVARRFNVDNOZ-HMRFFJRGSA-N |
| XLogP | 0.76 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol?
The IUPAC name of (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol (CID 155372664) is (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol.
What is the SMILES notation for (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol?
The canonical SMILES for (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol is CNCC(C)/C=C\C=C(/N)O.
What is the InChIKey of (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol?
The InChIKey is SQFVARRFNVDNOZ-HMRFFJRGSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(6-10-2)4-3-5-8(9)11/h3-5,7,10-11H,6,9H2,1-2H3/b4-3-,8-5+.
What are the key properties of (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol?
(1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol has a molecular weight of 156.23 g/mol, XLogP of 0.76, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,3Z)-1-amino-5-methyl-6-(methylamino)hexa-1,3-dien-1-ol is sourced from PubChem (CID 155372664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).