About 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine
1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine (PubChem CID 155372987) has the molecular formula C11H14F8N2
and a molecular weight of 326.23 g/mol. Its IUPAC name is 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine.
Molecular Properties
| Compound Name | 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine |
| PubChem CID | 155372987 |
| Molecular Formula | C11H14F8N2 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine |
| SMILES | C=C(C)[C@@](F)(C(F)N1CCN(C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C11H14F8N2/c1-7(2)9(13,10(14,15)16)8(12)20-3-5-21(6-4-20)11(17,18)19/h8H,1,3-6H2,2H3/t8?,9-/m1/s1 |
| InChIKey | VHNJEDWJUQKPPX-YGPZHTELSA-N |
| XLogP | 3.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine?
The IUPAC name of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine (CID 155372987) is 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine.
What is the SMILES notation for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine?
The canonical SMILES for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine is C=C(C)[C@@](F)(C(F)N1CCN(C(F)(F)F)CC1)C(F)(F)F.
What is the InChIKey of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine?
The InChIKey is VHNJEDWJUQKPPX-YGPZHTELSA-N. The full InChI is InChI=1S/C11H14F8N2/c1-7(2)9(13,10(14,15)16)8(12)20-3-5-21(6-4-20)11(17,18)19/h8H,1,3-6H2,2H3/t8?,9-/m1/s1.
What are the key properties of 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine?
1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine has a molecular weight of 326.23 g/mol, XLogP of 3.27, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]-4-(trifluoromethyl)piperazine is sourced from PubChem (CID 155372987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).