About 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine
4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine (PubChem CID 155372988) has the molecular formula C10H14F5NO
and a molecular weight of 259.22 g/mol. Its IUPAC name is 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine.
Molecular Properties
| Compound Name | 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine |
| PubChem CID | 155372988 |
| Molecular Formula | C10H14F5NO |
| Molecular Weight | 259.22 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine |
| SMILES | C=C(C)[C@@](F)(C(F)N1CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C10H14F5NO/c1-7(2)9(12,10(13,14)15)8(11)16-3-5-17-6-4-16/h8H,1,3-6H2,2H3/t8?,9-/m1/s1 |
| InChIKey | VEKRKBDVYGSRPD-YGPZHTELSA-N |
| XLogP | 2.46 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.22 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine?
The IUPAC name of 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine (CID 155372988) is 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine.
What is the SMILES notation for 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine?
The canonical SMILES for 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine is C=C(C)[C@@](F)(C(F)N1CCOCC1)C(F)(F)F.
What is the InChIKey of 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine?
The InChIKey is VEKRKBDVYGSRPD-YGPZHTELSA-N. The full InChI is InChI=1S/C10H14F5NO/c1-7(2)9(12,10(13,14)15)8(11)16-3-5-17-6-4-16/h8H,1,3-6H2,2H3/t8?,9-/m1/s1.
What are the key properties of 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine?
4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine has a molecular weight of 259.22 g/mol, XLogP of 2.46, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R)-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-enyl]morpholine is sourced from PubChem (CID 155372988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).