About N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine
N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine (PubChem CID 155372991) has the molecular formula C8H12F5N
and a molecular weight of 217.18 g/mol. Its IUPAC name is N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine.
Molecular Properties
| Compound Name | N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine |
| PubChem CID | 155372991 |
| Molecular Formula | C8H12F5N |
| Molecular Weight | 217.18 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine |
| SMILES | C=C(C)C(F)(C(F)NCC)C(F)(F)F |
| InChI | InChI=1S/C8H12F5N/c1-4-14-6(9)7(10,5(2)3)8(11,12)13/h6,14H,2,4H2,1,3H3 |
| InChIKey | DVOKBJBFODDNNW-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine?
The IUPAC name of N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine (CID 155372991) is N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine.
What is the SMILES notation for N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine?
The canonical SMILES for N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine is C=C(C)C(F)(C(F)NCC)C(F)(F)F.
What is the InChIKey of N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine?
The InChIKey is DVOKBJBFODDNNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F5N/c1-4-14-6(9)7(10,5(2)3)8(11,12)13/h6,14H,2,4H2,1,3H3.
What are the key properties of N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine?
N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine has a molecular weight of 217.18 g/mol, XLogP of 2.74, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-1,2-difluoro-3-methyl-2-(trifluoromethyl)but-3-en-1-amine is sourced from PubChem (CID 155372991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).