About 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide
2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide (PubChem CID 15537311) has the molecular formula C21H35NO3
and a molecular weight of 349.52 g/mol. Its IUPAC name is 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide.
Molecular Properties
| Compound Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide |
| PubChem CID | 15537311 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide |
| SMILES | CN(CCO)C(=O)C(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H35NO3/c1-19(2,3)15-12-14(13-16(17(15)24)20(4,5)6)21(7,8)18(25)22(9)10-11-23/h12-13,23-24H,10-11H2,1-9H3 |
| InChIKey | OMQTUBWMAXGZDP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide?
The IUPAC name of 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide (CID 15537311) is 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide.
What is the SMILES notation for 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide?
The canonical SMILES for 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide is CN(CCO)C(=O)C(C)(C)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide?
The InChIKey is OMQTUBWMAXGZDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35NO3/c1-19(2,3)15-12-14(13-16(17(15)24)20(4,5)6)21(7,8)18(25)22(9)10-11-23/h12-13,23-24H,10-11H2,1-9H3.
What are the key properties of 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide?
2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide has a molecular weight of 349.52 g/mol, XLogP of 3.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-ditert-butyl-4-hydroxyphenyl)-N-(2-hydroxyethyl)-N,2-dimethylpropanamide is sourced from PubChem (CID 15537311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).