About (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol
(3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol (PubChem CID 155373333) has the molecular formula C12H21NS
and a molecular weight of 211.37 g/mol. Its IUPAC name is (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol.
Molecular Properties
| Compound Name | (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol |
| PubChem CID | 155373333 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol |
| SMILES | C/C=C\C(=C/CCS)C1CCNCC1 |
| InChI | InChI=1S/C12H21NS/c1-2-4-11(5-3-10-14)12-6-8-13-9-7-12/h2,4-5,12-14H,3,6-10H2,1H3/b4-2-,11-5+ |
| InChIKey | LPXDMPMMRHOYJO-RPKNYPMHSA-N |
| XLogP | 2.81 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol?
The IUPAC name of (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol (CID 155373333) is (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol.
What is the SMILES notation for (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol?
The canonical SMILES for (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol is C/C=C\C(=C/CCS)C1CCNCC1.
What is the InChIKey of (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol?
The InChIKey is LPXDMPMMRHOYJO-RPKNYPMHSA-N. The full InChI is InChI=1S/C12H21NS/c1-2-4-11(5-3-10-14)12-6-8-13-9-7-12/h2,4-5,12-14H,3,6-10H2,1H3/b4-2-,11-5+.
What are the key properties of (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol?
(3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol has a molecular weight of 211.37 g/mol, XLogP of 2.81, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-4-piperidin-4-ylhepta-3,5-diene-1-thiol is sourced from PubChem (CID 155373333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).