About 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid
6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid (PubChem CID 15537344) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid.
Molecular Properties
| Compound Name | 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid |
| PubChem CID | 15537344 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid |
| SMILES | O=C(O)CCCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1 |
| InChI | InChI=1S/C21H21N3O3/c25-21(26)10-2-1-7-13-27-16-14-19(17-8-3-5-11-22-17)24-20(15-16)18-9-4-6-12-23-18/h3-6,8-9,11-12,14-15H,1-2,7,10,13H2,(H,25,26) |
| InChIKey | SWUABMPHXQCDEO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 85.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid?
The IUPAC name of 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid (CID 15537344) is 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid.
What is the SMILES notation for 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid?
The canonical SMILES for 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid is O=C(O)CCCCCOc1cc(-c2ccccn2)nc(-c2ccccn2)c1.
What is the InChIKey of 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid?
The InChIKey is SWUABMPHXQCDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c25-21(26)10-2-1-7-13-27-16-14-19(17-8-3-5-11-22-17)24-20(15-16)18-9-4-6-12-23-18/h3-6,8-9,11-12,14-15H,1-2,7,10,13H2,(H,25,26).
What are the key properties of 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid?
6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid has a molecular weight of 363.42 g/mol, XLogP of 4.23, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,6-dipyridin-2-yl-4-pyridinyl)oxy]hexanoic acid is sourced from PubChem (CID 15537344), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).