C16H19N — CID 155373780
1-[(5Z)-hepta-1,5-dien-2-yl]-4,4a-dihydroisoquinoline (PubChem CID 155373780) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 1-[(5Z)-hepta-1,5-dien-2-yl]-4,4a-dihydroisoquinoline.
| Compound Name | 1-[(5Z)-hepta-1,5-dien-2-yl]-4,4a-dihydroisoquinoline |
|---|---|
| PubChem CID | 155373780 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-[(5Z)-hepta-1,5-dien-2-yl]-4,4a-dihydroisoquinoline |
| SMILES | C=C(CC/C=C\C)C1=C2C=CC=CC2CC=N1 |
| InChI | InChI=1S/C16H19N/c1-3-4-5-8-13(2)16-15-10-7-6-9-14(15)11-12-17-16/h3-4,6-7,9-10,12,14H,2,5,8,11H2,1H3/b4-3- |
| InChIKey | FIANFAQKQXNRBX-ARJAWSKDSA-N |
| XLogP | 4.37 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|