About N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine
N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine (PubChem CID 155373883) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine.
Molecular Properties
| Compound Name | N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine |
| PubChem CID | 155373883 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine |
| SMILES | C/C=C(CCC)\N=C(/C)C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-7-9-11(8-2)13-10(3)12(4,5)6/h8H,7,9H2,1-6H3/b11-8-,13-10+ |
| InChIKey | JBTRVKRFZKWUBV-HIIDVJQZSA-N |
| XLogP | 4.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine?
The IUPAC name of N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine (CID 155373883) is N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine.
What is the SMILES notation for N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine?
The canonical SMILES for N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine is C/C=C(CCC)\N=C(/C)C(C)(C)C.
What is the InChIKey of N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine?
The InChIKey is JBTRVKRFZKWUBV-HIIDVJQZSA-N. The full InChI is InChI=1S/C12H23N/c1-7-9-11(8-2)13-10(3)12(4,5)6/h8H,7,9H2,1-6H3/b11-8-,13-10+.
What are the key properties of N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine?
N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine has a molecular weight of 181.32 g/mol, XLogP of 4.20, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-hex-2-en-3-yl]-3,3-dimethylbutan-2-imine is sourced from PubChem (CID 155373883), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).