C25H31N5O — CID 155373921
(2R,6S,9R)-9-(1-methylpiperidin-4-yl)-6-(3-methyl-2-pyridinyl)-8-oxa-7,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),12,14,16-tetraene (PubChem CID 155373921) has the molecular formula C25H31N5O and a molecular weight of 417.56 g/mol. Its IUPAC name is (2R,6S,9R)-9-(1-methylpiperidin-4-yl)-6-(3-methyl-2-pyridinyl)-8-oxa-7,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),12,14,16-tetraene.
| Compound Name | (2R,6S,9R)-9-(1-methylpiperidin-4-yl)-6-(3-methyl-2-pyridinyl)-8-oxa-7,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),12,14,16-tetraene |
|---|---|
| PubChem CID | 155373921 |
| Molecular Formula | C25H31N5O |
| Molecular Weight | 417.56 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | (2R,6S,9R)-9-(1-methylpiperidin-4-yl)-6-(3-methyl-2-pyridinyl)-8-oxa-7,11,17-triazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),12,14,16-tetraene |
| SMILES | Cc1cccnc1[C@@H]1CCC[C@@H]2c3nc4ccccn4c3[C@@H](C3CCN(C)CC3)ON21 |
| InChI | InChI=1S/C25H31N5O/c1-17-7-6-13-26-22(17)19-8-5-9-20-23-24(29-14-4-3-10-21(29)27-23)25(31-30(19)20)18-11-15-28(2)16-12-18/h3-4,6-7,10,13-14,18-20,25H,5,8-9,11-12,15-16H2,1-2H3/t19-,20+,25+/m0/s1 |
| InChIKey | YTVPPFLXRJAVSJ-WZOHSFFVSA-N |
| XLogP | 4.63 |
| TPSA | 45.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |