C13H21N — CID 155374096
(3Z,5Z,8Z)-N,N-dimethyl-7-methylidenedeca-3,5,8-trien-1-amine (PubChem CID 155374096) has the molecular formula C13H21N and a molecular weight of 191.32 g/mol. Its IUPAC name is (3Z,5Z,8Z)-N,N-dimethyl-7-methylidenedeca-3,5,8-trien-1-amine.
| Compound Name | (3Z,5Z,8Z)-N,N-dimethyl-7-methylidenedeca-3,5,8-trien-1-amine |
|---|---|
| PubChem CID | 155374096 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | (3Z,5Z,8Z)-N,N-dimethyl-7-methylidenedeca-3,5,8-trien-1-amine |
| SMILES | C=C(/C=C\C)/C=C\C=C/CCN(C)C |
| InChI | InChI=1S/C13H21N/c1-5-10-13(2)11-8-6-7-9-12-14(3)4/h5-8,10-11H,2,9,12H2,1,3-4H3/b7-6-,10-5-,11-8- |
| InChIKey | ALLCUOVBQRZLRY-WWAJRPLYSA-N |
| XLogP | 3.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|