About 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine
1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine (PubChem CID 155374205) has the molecular formula C6H14N2O
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine |
| PubChem CID | 155374205 |
| Molecular Formula | C6H14N2O |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.11 |
| IUPAC Name | 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine |
| SMILES | CNN(C)/C=C(\C)OC |
| InChI | InChI=1S/C6H14N2O/c1-6(9-4)5-8(3)7-2/h5,7H,1-4H3/b6-5+ |
| InChIKey | GWMYAANPOAJMLP-AATRIKPKSA-N |
| XLogP | 0.56 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine?
The IUPAC name of 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine (CID 155374205) is 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine.
What is the SMILES notation for 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine?
The canonical SMILES for 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine is CNN(C)/C=C(\C)OC.
What is the InChIKey of 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine?
The InChIKey is GWMYAANPOAJMLP-AATRIKPKSA-N. The full InChI is InChI=1S/C6H14N2O/c1-6(9-4)5-8(3)7-2/h5,7H,1-4H3/b6-5+.
What are the key properties of 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine?
1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine has a molecular weight of 130.19 g/mol, XLogP of 0.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-methoxyprop-1-enyl]-1,2-dimethylhydrazine is sourced from PubChem (CID 155374205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).