C7H9NS — CID 155374243
(1Z,3Z)-2-(methylideneamino)hexa-1,3,5-triene-1-thiol (PubChem CID 155374243) has the molecular formula C7H9NS and a molecular weight of 139.22 g/mol. Its IUPAC name is (1Z,3Z)-2-(methylideneamino)hexa-1,3,5-triene-1-thiol.
| Compound Name | (1Z,3Z)-2-(methylideneamino)hexa-1,3,5-triene-1-thiol |
|---|---|
| PubChem CID | 155374243 |
| Molecular Formula | C7H9NS |
| Molecular Weight | 139.22 g/mol |
| Exact Mass | 139.05 |
| IUPAC Name | (1Z,3Z)-2-(methylideneamino)hexa-1,3,5-triene-1-thiol |
| SMILES | C=C/C=C\C(=C\S)N=C |
| InChI | InChI=1S/C7H9NS/c1-3-4-5-7(6-9)8-2/h3-6,9H,1-2H2/b5-4-,7-6- |
| InChIKey | FOVRNCOSWYSWJG-RZSVFLSASA-N |
| XLogP | 2.20 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.22 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|