C21H17N3O2 — CID 155374553
4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-N-phenylaniline (PubChem CID 155374553) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-N-phenylaniline.
| Compound Name | 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 155374553 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 4-[5-(4-methoxyphenyl)-1,2,4-oxadiazol-3-yl]-N-phenylaniline |
| SMILES | COc1ccc(-c2nc(-c3ccc(Nc4ccccc4)cc3)no2)cc1 |
| InChI | InChI=1S/C21H17N3O2/c1-25-19-13-9-16(10-14-19)21-23-20(24-26-21)15-7-11-18(12-8-15)22-17-5-3-2-4-6-17/h2-14,22H,1H3 |
| InChIKey | WWEYSCYQKZDDIM-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |