C43H36N4 — CID 155374966
3-[3-(2,6-dipyridin-3-yl-4-pyridinyl)-1-adamantyl]-9-phenylcarbazole (PubChem CID 155374966) has the molecular formula C43H36N4 and a molecular weight of 608.79 g/mol. Its IUPAC name is 3-[3-(2,6-dipyridin-3-yl-4-pyridinyl)-1-adamantyl]-9-phenylcarbazole.
| Compound Name | 3-[3-(2,6-dipyridin-3-yl-4-pyridinyl)-1-adamantyl]-9-phenylcarbazole |
|---|---|
| PubChem CID | 155374966 |
| Molecular Formula | C43H36N4 |
| Molecular Weight | 608.79 g/mol |
| Exact Mass | 608.29 |
| IUPAC Name | 3-[3-(2,6-dipyridin-3-yl-4-pyridinyl)-1-adamantyl]-9-phenylcarbazole |
| SMILES | c1ccc(-n2c3ccccc3c3cc(C45CC6CC(CC(c7cc(-c8cccnc8)nc(-c8cccnc8)c7)(C6)C4)C5)ccc32)cc1 |
| InChI | InChI=1S/C43H36N4/c1-2-10-35(11-3-1)47-40-13-5-4-12-36(40)37-19-33(14-15-41(37)47)42-22-29-18-30(23-42)25-43(24-29,28-42)34-20-38(31-8-6-16-44-26-31)46-39(21-34)32-9-7-17-45-27-32/h1-17,19-21,26-27,29-30H,18,22-25,28H2 |
| InChIKey | OGOFPMPRBQIOFR-UHFFFAOYSA-N |
| XLogP | 10.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.79 |
| LogP ≤ 5 | 10.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |