C27H41FN4OS — CID 155375051
N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]-N-prop-2-enylformamide (PubChem CID 155375051) has the molecular formula C27H41FN4OS and a molecular weight of 488.72 g/mol. Its IUPAC name is N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]-N-prop-2-enylformamide.
| Compound Name | N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]-N-prop-2-enylformamide |
|---|---|
| PubChem CID | 155375051 |
| Molecular Formula | C27H41FN4OS |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | N-[[4-[C-[(Z)-4-fluoropent-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]methyl]-N-prop-2-enylformamide |
| SMILES | C=CCN(C=O)CC1CC2=C(C(/C=C\CC(C)F)=N/C)CN=C(C(S/C=C\C)C(C)CC)N2C1 |
| InChI | InChI=1S/C27H41FN4OS/c1-7-13-31(19-33)17-22-15-25-23(24(29-6)12-10-11-21(5)28)16-30-27(32(25)18-22)26(20(4)9-3)34-14-8-2/h7-8,10,12,14,19-22,26H,1,9,11,13,15-18H2,2-6H3/b12-10-,14-8-,29-24+ |
| InChIKey | NQNXHZNQMYMERP-YPBJQKMJSA-N |
| XLogP | 5.68 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|