C24H18FN6O7S2- — CID 155375859
[5-[[4-benzylsulfonyl-8-[carboxy(methyl)amino]-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]methanesulfinate (PubChem CID 155375859) has the molecular formula C24H18FN6O7S2- and a molecular weight of 585.58 g/mol. Its IUPAC name is [5-[[4-benzylsulfonyl-8-[carboxy(methyl)amino]-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]methanesulfinate.
| Compound Name | [5-[[4-benzylsulfonyl-8-[carboxy(methyl)amino]-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]methanesulfinate |
|---|---|
| PubChem CID | 155375859 |
| Molecular Formula | C24H18FN6O7S2- |
| Molecular Weight | 585.58 g/mol |
| Exact Mass | 585.07 |
| IUPAC Name | [5-[[4-benzylsulfonyl-8-[carboxy(methyl)amino]-6-fluoro-9H-pyrimido[4,5-b]indol-2-yl]oxy]pyrimidin-2-yl]methanesulfinate |
| SMILES | CN(C(=O)O)c1cc(F)cc2c1[nH]c1nc(Oc3cnc(CS(=O)[O-])nc3)nc(S(=O)(=O)Cc3ccccc3)c12 |
| InChI | InChI=1S/C24H19FN6O7S2/c1-31(24(32)33)17-8-14(25)7-16-19-21(28-20(16)17)29-23(38-15-9-26-18(27-10-15)11-39(34)35)30-22(19)40(36,37)12-13-5-3-2-4-6-13/h2-10H,11-12H2,1H3,(H,32,33)(H,34,35)(H,28,29,30)/p-1 |
| InChIKey | FJYSAGJDSIQTEF-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 191.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.58 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|