C20H14ClF7N8 — CID 155376304
5-chloro-N-(2-methylpyrazol-3-yl)-4-[5-(1,1,2,2-tetrafluoroethyl)-8-(trifluoromethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]pyridin-2-amine (PubChem CID 155376304) has the molecular formula C20H14ClF7N8 and a molecular weight of 534.83 g/mol. Its IUPAC name is 5-chloro-N-(2-methylpyrazol-3-yl)-4-[5-(1,1,2,2-tetrafluoroethyl)-8-(trifluoromethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]pyridin-2-amine.
| Compound Name | 5-chloro-N-(2-methylpyrazol-3-yl)-4-[5-(1,1,2,2-tetrafluoroethyl)-8-(trifluoromethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 155376304 |
| Molecular Formula | C20H14ClF7N8 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | 5-chloro-N-(2-methylpyrazol-3-yl)-4-[5-(1,1,2,2-tetrafluoroethyl)-8-(trifluoromethyl)-3,4,6,9-tetrazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,10-tetraen-11-yl]pyridin-2-amine |
| SMILES | Cn1nccc1Nc1cc(-c2cc3n(c2)C(C(F)(F)F)Cn2c-3nnc2C(F)(F)C(F)F)c(Cl)cn1 |
| InChI | InChI=1S/C20H14ClF7N8/c1-34-15(2-3-30-34)31-14-5-10(11(21)6-29-14)9-4-12-16-32-33-18(19(24,25)17(22)23)36(16)8-13(20(26,27)28)35(12)7-9/h2-7,13,17H,8H2,1H3,(H,29,31) |
| InChIKey | YINMVHGNJWLNGF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 78.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|