C46H26N4OS — CID 155377143
3-(9-dibenzothiophen-1-yldibenzofuran-3-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile (PubChem CID 155377143) has the molecular formula C46H26N4OS and a molecular weight of 682.81 g/mol. Its IUPAC name is 3-(9-dibenzothiophen-1-yldibenzofuran-3-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile.
| Compound Name | 3-(9-dibenzothiophen-1-yldibenzofuran-3-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
|---|---|
| PubChem CID | 155377143 |
| Molecular Formula | C46H26N4OS |
| Molecular Weight | 682.81 g/mol |
| Exact Mass | 682.18 |
| IUPAC Name | 3-(9-dibenzothiophen-1-yldibenzofuran-3-yl)-5-(4,6-diphenyl-1,3,5-triazin-2-yl)benzonitrile |
| SMILES | N#Cc1cc(-c2ccc3c(c2)oc2cccc(-c4cccc5sc6ccccc6c45)c23)cc(-c2nc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| InChI | InChI=1S/C46H26N4OS/c47-27-28-23-32(25-33(24-28)46-49-44(29-11-3-1-4-12-29)48-45(50-46)30-13-5-2-6-14-30)31-21-22-36-39(26-31)51-38-18-9-16-34(42(36)38)35-17-10-20-41-43(35)37-15-7-8-19-40(37)52-41/h1-26H |
| InChIKey | NFRQYTAXGYWWTD-UHFFFAOYSA-N |
| XLogP | 12.35 |
| TPSA | 75.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.81 |
| LogP ≤ 5 | 12.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |