C21H20ClFN2O2 — CID 155377365
6-chloro-5-fluoro-3-(1-methylpiperidin-4-yl)-1-phenylindole-2-carboxylic acid (PubChem CID 155377365) has the molecular formula C21H20ClFN2O2 and a molecular weight of 386.85 g/mol. Its IUPAC name is 6-chloro-5-fluoro-3-(1-methylpiperidin-4-yl)-1-phenylindole-2-carboxylic acid.
| Compound Name | 6-chloro-5-fluoro-3-(1-methylpiperidin-4-yl)-1-phenylindole-2-carboxylic acid |
|---|---|
| PubChem CID | 155377365 |
| Molecular Formula | C21H20ClFN2O2 |
| Molecular Weight | 386.85 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 6-chloro-5-fluoro-3-(1-methylpiperidin-4-yl)-1-phenylindole-2-carboxylic acid |
| SMILES | CN1CCC(c2c(C(=O)O)n(-c3ccccc3)c3cc(Cl)c(F)cc23)CC1 |
| InChI | InChI=1S/C21H20ClFN2O2/c1-24-9-7-13(8-10-24)19-15-11-17(23)16(22)12-18(15)25(20(19)21(26)27)14-5-3-2-4-6-14/h2-6,11-13H,7-10H2,1H3,(H,26,27) |
| InChIKey | JYSXEDDJAACXLO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.85 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |