C8H13F3O — CID 155378097
(2R)-1,1,1-trifluoro-4,4-dimethylhex-5-en-2-ol (PubChem CID 155378097) has the molecular formula C8H13F3O and a molecular weight of 182.18 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-4,4-dimethylhex-5-en-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-4,4-dimethylhex-5-en-2-ol |
|---|---|
| PubChem CID | 155378097 |
| Molecular Formula | C8H13F3O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2R)-1,1,1-trifluoro-4,4-dimethylhex-5-en-2-ol |
| SMILES | C=CC(C)(C)C[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3O/c1-4-7(2,3)5-6(12)8(9,10)11/h4,6,12H,1,5H2,2-3H3/t6-/m1/s1 |
| InChIKey | MIQIGROGNCKJSU-ZCFIWIBFSA-N |
| XLogP | 2.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|