About (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole
(4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole (PubChem CID 155378107) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole.
Molecular Properties
| Compound Name | (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole |
| PubChem CID | 155378107 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole |
| SMILES | C=C/C=c1/cnn(C(C)(C)C)/c1=C/C=C |
| InChI | InChI=1S/C13H18N2/c1-6-8-11-10-14-15(13(3,4)5)12(11)9-7-2/h6-10H,1-2H2,3-5H3/b11-8-,12-9+ |
| InChIKey | XDTPDIPYJGXCQS-QABOREQESA-N |
| XLogP | 1.57 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole?
The IUPAC name of (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole (CID 155378107) is (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole.
What is the SMILES notation for (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole?
The canonical SMILES for (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole is C=C/C=c1/cnn(C(C)(C)C)/c1=C/C=C.
What is the InChIKey of (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole?
The InChIKey is XDTPDIPYJGXCQS-QABOREQESA-N. The full InChI is InChI=1S/C13H18N2/c1-6-8-11-10-14-15(13(3,4)5)12(11)9-7-2/h6-10H,1-2H2,3-5H3/b11-8-,12-9+.
What are the key properties of (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole?
(4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole has a molecular weight of 202.30 g/mol, XLogP of 1.57, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E,5E)-1-tert-butyl-4,5-bis(prop-2-enylidene)pyrazole is sourced from PubChem (CID 155378107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).