About (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate
(2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate (PubChem CID 155378273) has the molecular formula C13H17NO4
and a molecular weight of 251.28 g/mol. Its IUPAC name is (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate.
Molecular Properties
| Compound Name | (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate |
| PubChem CID | 155378273 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate |
| SMILES | CC1COC(COC(=O)C2=CN(C)C=CC2)=CO1 |
| InChI | InChI=1S/C13H17NO4/c1-10-7-17-12(8-16-10)9-18-13(15)11-4-3-5-14(2)6-11/h3,5-6,8,10H,4,7,9H2,1-2H3 |
| InChIKey | CWCUGLDHRIDLOT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The IUPAC name of (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate (CID 155378273) is (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate.
What is the SMILES notation for (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The canonical SMILES for (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate is CC1COC(COC(=O)C2=CN(C)C=CC2)=CO1.
What is the InChIKey of (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
The InChIKey is CWCUGLDHRIDLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO4/c1-10-7-17-12(8-16-10)9-18-13(15)11-4-3-5-14(2)6-11/h3,5-6,8,10H,4,7,9H2,1-2H3.
What are the key properties of (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate?
(2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate has a molecular weight of 251.28 g/mol, XLogP of 1.54, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methyl-2,3-dihydro-1,4-dioxin-5-yl)methyl 1-methyl-4H-pyridine-3-carboxylate is sourced from PubChem (CID 155378273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).