About N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine
N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine (PubChem CID 155378449) has the molecular formula C14H20F3N3O
and a molecular weight of 303.33 g/mol. Its IUPAC name is N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 155378449 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine |
| SMILES | CON1CCC[C@@H](C)[C@H]1CNc1ccc(C(F)(F)F)cn1 |
| InChI | InChI=1S/C14H20F3N3O/c1-10-4-3-7-20(21-2)12(10)9-19-13-6-5-11(8-18-13)14(15,16)17/h5-6,8,10,12H,3-4,7,9H2,1-2H3,(H,18,19)/t10-,12-/m1/s1 |
| InChIKey | JPRZFKKKBXPEPN-ZYHUDNBSSA-N |
| XLogP | 3.17 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine (CID 155378449) is N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine is CON1CCC[C@@H](C)[C@H]1CNc1ccc(C(F)(F)F)cn1.
What is the InChIKey of N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine?
The InChIKey is JPRZFKKKBXPEPN-ZYHUDNBSSA-N. The full InChI is InChI=1S/C14H20F3N3O/c1-10-4-3-7-20(21-2)12(10)9-19-13-6-5-11(8-18-13)14(15,16)17/h5-6,8,10,12H,3-4,7,9H2,1-2H3,(H,18,19)/t10-,12-/m1/s1.
What are the key properties of N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine?
N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine has a molecular weight of 303.33 g/mol, XLogP of 3.17, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2S,3R)-1-methoxy-3-methylpiperidin-2-yl]methyl]-5-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 155378449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).