C32H29ClN2O3 — CID 15537897
(1S,2S,13R,21R)-11-[(4-chlorophenyl)methyl]-22-prop-2-enyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol (PubChem CID 15537897) has the molecular formula C32H29ClN2O3 and a molecular weight of 525.05 g/mol. Its IUPAC name is (1S,2S,13R,21R)-11-[(4-chlorophenyl)methyl]-22-prop-2-enyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol.
| Compound Name | (1S,2S,13R,21R)-11-[(4-chlorophenyl)methyl]-22-prop-2-enyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol |
|---|---|
| PubChem CID | 15537897 |
| Molecular Formula | C32H29ClN2O3 |
| Molecular Weight | 525.05 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | (1S,2S,13R,21R)-11-[(4-chlorophenyl)methyl]-22-prop-2-enyl-14-oxa-11,22-diazaheptacyclo[13.9.1.01,13.02,21.04,12.05,10.019,25]pentacosa-4(12),5,7,9,15,17,19(25)-heptaene-2,16-diol |
| SMILES | C=CCN1CC[C@]23c4c5ccc(O)c4O[C@H]2c2c(c4ccccc4n2Cc2ccc(Cl)cc2)C[C@@]3(O)[C@H]1C5 |
| InChI | InChI=1S/C32H29ClN2O3/c1-2-14-34-15-13-31-27-20-9-12-25(36)29(27)38-30(31)28-23(17-32(31,37)26(34)16-20)22-5-3-4-6-24(22)35(28)18-19-7-10-21(33)11-8-19/h2-12,26,30,36-37H,1,13-18H2/t26-,30+,31+,32-/m1/s1 |
| InChIKey | CTWJRZHPEWMRTA-SSHYCOHZSA-N |
| XLogP | 5.52 |
| TPSA | 57.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.05 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|