C21H29FN2S — CID 155379623
4-[(3E,5Z)-8-fluoronona-3,5-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 155379623) has the molecular formula C21H29FN2S and a molecular weight of 360.54 g/mol. Its IUPAC name is 4-[(3E,5Z)-8-fluoronona-3,5-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 4-[(3E,5Z)-8-fluoronona-3,5-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 155379623 |
| Molecular Formula | C21H29FN2S |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 4-[(3E,5Z)-8-fluoronona-3,5-dien-4-yl]-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | C=C(S/C=C\C)C1=NCC(C(/C=C\CC(C)F)=C/CC)=C2CCCN12 |
| InChI | InChI=1S/C21H29FN2S/c1-5-9-18(11-7-10-16(3)22)19-15-23-21(17(4)25-14-6-2)24-13-8-12-20(19)24/h6-7,9,11,14,16H,4-5,8,10,12-13,15H2,1-3H3/b11-7-,14-6-,18-9+ |
| InChIKey | VREFOVVODDVJKI-LYQSVKISSA-N |
| XLogP | 6.17 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|