C26H30F5N7O — CID 155379722
N-[3-[2-(dimethylamino)pyrimidin-5-yl]-2,4-difluoro-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(trifluoromethyl)-1,2-dihydropyridine-5-carboxamide (PubChem CID 155379722) has the molecular formula C26H30F5N7O and a molecular weight of 551.56 g/mol. Its IUPAC name is N-[3-[2-(dimethylamino)pyrimidin-5-yl]-2,4-difluoro-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(trifluoromethyl)-1,2-dihydropyridine-5-carboxamide.
| Compound Name | N-[3-[2-(dimethylamino)pyrimidin-5-yl]-2,4-difluoro-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(trifluoromethyl)-1,2-dihydropyridine-5-carboxamide |
|---|---|
| PubChem CID | 155379722 |
| Molecular Formula | C26H30F5N7O |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | N-[3-[2-(dimethylamino)pyrimidin-5-yl]-2,4-difluoro-6-[(3S,5R)-3,4,5-trimethylpiperazin-1-yl]phenyl]-4-(trifluoromethyl)-1,2-dihydropyridine-5-carboxamide |
| SMILES | C[C@@H]1CN(c2cc(F)c(-c3cnc(N(C)C)nc3)c(F)c2NC(=O)C2=CNCC=C2C(F)(F)F)C[C@H](C)N1C |
| InChI | InChI=1S/C26H30F5N7O/c1-14-12-38(13-15(2)37(14)5)20-8-19(27)21(16-9-33-25(34-10-16)36(3)4)22(28)23(20)35-24(39)17-11-32-7-6-18(17)26(29,30)31/h6,8-11,14-15,32H,7,12-13H2,1-5H3,(H,35,39)/t14-,15+ |
| InChIKey | RPEAYQBWMSZJRU-GASCZTMLSA-N |
| XLogP | 3.93 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |