C23H34F2N4OS — CID 155379978
N-[4-[C-[(Z)-4,4-difluorobut-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide (PubChem CID 155379978) has the molecular formula C23H34F2N4OS and a molecular weight of 452.62 g/mol. Its IUPAC name is N-[4-[C-[(Z)-4,4-difluorobut-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide.
| Compound Name | N-[4-[C-[(Z)-4,4-difluorobut-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide |
|---|---|
| PubChem CID | 155379978 |
| Molecular Formula | C23H34F2N4OS |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.24 |
| IUPAC Name | N-[4-[C-[(Z)-4,4-difluorobut-1-enyl]-N-methylcarbonimidoyl]-1-[2-methyl-1-[(Z)-prop-1-enyl]sulfanylbutyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidin-6-yl]acetamide |
| SMILES | C/C=C\SC(C1=NCC(C(/C=C\CC(F)F)=N/C)=C2CC(NC(C)=O)CN12)C(C)CC |
| InChI | InChI=1S/C23H34F2N4OS/c1-6-11-31-22(15(3)7-2)23-27-13-18(19(26-5)9-8-10-21(24)25)20-12-17(14-29(20)23)28-16(4)30/h6,8-9,11,15,17,21-22H,7,10,12-14H2,1-5H3,(H,28,30)/b9-8-,11-6-,26-19+ |
| InChIKey | STEXRINXWPXEEX-UESXTKCBSA-N |
| XLogP | 4.83 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|