C20H28N2S — CID 155380031
4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-methyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine (PubChem CID 155380031) has the molecular formula C20H28N2S and a molecular weight of 328.53 g/mol. Its IUPAC name is 4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-methyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine.
| Compound Name | 4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-methyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
|---|---|
| PubChem CID | 155380031 |
| Molecular Formula | C20H28N2S |
| Molecular Weight | 328.53 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | 4-[(2Z,4E)-hepta-2,4-dien-4-yl]-6-methyl-1-[1-[(Z)-prop-1-enyl]sulfanylethenyl]-3,5,6,7-tetrahydropyrrolo[1,2-c]pyrimidine |
| SMILES | C=C(S/C=C\C)C1=NCC(C(/C=C\C)=C/CC)=C2CC(C)CN12 |
| InChI | InChI=1S/C20H28N2S/c1-6-9-17(10-7-2)18-13-21-20(16(5)23-11-8-3)22-14-15(4)12-19(18)22/h6,8-11,15H,5,7,12-14H2,1-4H3/b9-6-,11-8-,17-10+ |
| InChIKey | GUESCKPUIZQCGM-MJWRZPRQSA-N |
| XLogP | 5.69 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|