C25H34O2 — CID 155380161
(3E,5E)-6-[1-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]-3,3,5-trimethylcyclohexyl]octa-1,3,5,7-tetraen-3-ol (PubChem CID 155380161) has the molecular formula C25H34O2 and a molecular weight of 366.55 g/mol. Its IUPAC name is (3E,5E)-6-[1-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]-3,3,5-trimethylcyclohexyl]octa-1,3,5,7-tetraen-3-ol.
| Compound Name | (3E,5E)-6-[1-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]-3,3,5-trimethylcyclohexyl]octa-1,3,5,7-tetraen-3-ol |
|---|---|
| PubChem CID | 155380161 |
| Molecular Formula | C25H34O2 |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | (3E,5E)-6-[1-[(3E,5E)-6-hydroxyocta-1,3,5,7-tetraen-3-yl]-3,3,5-trimethylcyclohexyl]octa-1,3,5,7-tetraen-3-ol |
| SMILES | C=C/C(O)=C\C=C(/C=C)C1(/C(C=C)=C/C=C(/O)C=C)CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C25H34O2/c1-8-20(12-14-22(26)10-3)25(17-19(5)16-24(6,7)18-25)21(9-2)13-15-23(27)11-4/h8-15,19,26-27H,1-4,16-18H2,5-7H3/b20-12+,21-13+,22-14+,23-15+ |
| InChIKey | GHQFMQWNQURIGL-LDWHALDUSA-N |
| XLogP | 7.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|