C27H32N6O2S — CID 155380618
N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide (PubChem CID 155380618) has the molecular formula C27H32N6O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide.
| Compound Name | N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 155380618 |
| Molecular Formula | C27H32N6O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N-[5-[[[(2S)-3,3-dimethylbutan-2-yl]amino]methyl]-1-[3-(1-hydroxyprop-2-enylamino)phenyl]benzimidazol-2-yl]-1,2-thiazole-5-carboxamide |
| SMILES | C=CC(O)Nc1cccc(-n2c(NC(=O)c3ccns3)nc3cc(CN[C@@H](C)C(C)(C)C)ccc32)c1 |
| InChI | InChI=1S/C27H32N6O2S/c1-6-24(34)30-19-8-7-9-20(15-19)33-22-11-10-18(16-28-17(2)27(3,4)5)14-21(22)31-26(33)32-25(35)23-12-13-29-36-23/h6-15,17,24,28,30,34H,1,16H2,2-5H3,(H,31,32,35)/t17-,24?/m0/s1 |
| InChIKey | NFDRIGGTINJVFH-KEJDIYNNSA-N |
| XLogP | 5.17 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|