C31H32N6O5S2 — CID 155380772
(1S,4S,7R,9S)-9-[4-(3-azidopropoxy)phenyl]-16-(benzenesulfonyl)-4,5,7-trimethyl-4-sulfanyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione (PubChem CID 155380772) has the molecular formula C31H32N6O5S2 and a molecular weight of 632.77 g/mol. Its IUPAC name is (1S,4S,7R,9S)-9-[4-(3-azidopropoxy)phenyl]-16-(benzenesulfonyl)-4,5,7-trimethyl-4-sulfanyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione.
| Compound Name | (1S,4S,7R,9S)-9-[4-(3-azidopropoxy)phenyl]-16-(benzenesulfonyl)-4,5,7-trimethyl-4-sulfanyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
|---|---|
| PubChem CID | 155380772 |
| Molecular Formula | C31H32N6O5S2 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.19 |
| IUPAC Name | (1S,4S,7R,9S)-9-[4-(3-azidopropoxy)phenyl]-16-(benzenesulfonyl)-4,5,7-trimethyl-4-sulfanyl-2,5,16-triazatetracyclo[7.7.0.02,7.010,15]hexadeca-10,12,14-triene-3,6-dione |
| SMILES | CN1C(=O)[C@@]2(C)C[C@]3(c4ccc(OCCCN=[N+]=[N-])cc4)c4ccccc4N(S(=O)(=O)c4ccccc4)[C@@H]3N2C(=O)[C@]1(C)S |
| InChI | InChI=1S/C31H32N6O5S2/c1-29-20-31(21-14-16-22(17-15-21)42-19-9-18-33-34-32)24-12-7-8-13-25(24)37(44(40,41)23-10-5-4-6-11-23)26(31)36(29)28(39)30(2,43)35(3)27(29)38/h4-8,10-17,26,43H,9,18-20H2,1-3H3/t26-,29+,30-,31-/m0/s1 |
| InChIKey | FIACWIKSCCCEPQ-CKQDHXSNSA-N |
| XLogP | 4.70 |
| TPSA | 135.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|