C21H18F4N6O3S — CID 155380963
(1S,2R,3S,4R)-4-[2-[2-(5-fluorothiophen-2-yl)ethynyl]-6-(methylamino)-8-(trifluoromethyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide (PubChem CID 155380963) has the molecular formula C21H18F4N6O3S and a molecular weight of 510.47 g/mol. Its IUPAC name is (1S,2R,3S,4R)-4-[2-[2-(5-fluorothiophen-2-yl)ethynyl]-6-(methylamino)-8-(trifluoromethyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide.
| Compound Name | (1S,2R,3S,4R)-4-[2-[2-(5-fluorothiophen-2-yl)ethynyl]-6-(methylamino)-8-(trifluoromethyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
|---|---|
| PubChem CID | 155380963 |
| Molecular Formula | C21H18F4N6O3S |
| Molecular Weight | 510.47 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | (1S,2R,3S,4R)-4-[2-[2-(5-fluorothiophen-2-yl)ethynyl]-6-(methylamino)-8-(trifluoromethyl)purin-9-yl]-2,3-dihydroxy-N-methylbicyclo[3.1.0]hexane-1-carboxamide |
| SMILES | CNC(=O)[C@@]12CC1[C@@H](n1c(C(F)(F)F)nc3c(NC)nc(C#Cc4ccc(F)s4)nc31)[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C21H18F4N6O3S/c1-26-16-12-17(29-11(28-16)6-4-8-3-5-10(22)35-8)31(18(30-12)21(23,24)25)13-9-7-20(9,19(34)27-2)15(33)14(13)32/h3,5,9,13-15,32-33H,7H2,1-2H3,(H,27,34)(H,26,28,29)/t9?,13-,14+,15+,20+/m1/s1 |
| InChIKey | SVUYKUWDQDDRJJ-PQSGJCQOSA-N |
| XLogP | 1.52 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.47 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|