C30H37ClN8O5S — CID 155381033
[2-[(2S)-2-amino-3-methylbutanoyl]oxy-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-1-(methylcarbamoyl)-3-bicyclo[3.1.0]hexanyl] (2S)-2-amino-3-methylbutanoate (PubChem CID 155381033) has the molecular formula C30H37ClN8O5S and a molecular weight of 657.20 g/mol. Its IUPAC name is [2-[(2S)-2-amino-3-methylbutanoyl]oxy-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-1-(methylcarbamoyl)-3-bicyclo[3.1.0]hexanyl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [2-[(2S)-2-amino-3-methylbutanoyl]oxy-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-1-(methylcarbamoyl)-3-bicyclo[3.1.0]hexanyl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 155381033 |
| Molecular Formula | C30H37ClN8O5S |
| Molecular Weight | 657.20 g/mol |
| Exact Mass | 656.23 |
| IUPAC Name | [2-[(2S)-2-amino-3-methylbutanoyl]oxy-4-[2-[2-(5-chlorothiophen-2-yl)ethynyl]-6-(methylamino)purin-9-yl]-1-(methylcarbamoyl)-3-bicyclo[3.1.0]hexanyl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CNC(=O)C12CC1C(n1cnc3c(NC)nc(C#Cc4ccc(Cl)s4)nc31)C(OC(=O)[C@@H](N)C(C)C)C2OC(=O)[C@@H](N)C(C)C |
| InChI | InChI=1S/C30H37ClN8O5S/c1-13(2)19(32)27(40)43-23-22(16-11-30(16,29(42)35-6)24(23)44-28(41)20(33)14(3)4)39-12-36-21-25(34-5)37-18(38-26(21)39)10-8-15-7-9-17(31)45-15/h7,9,12-14,16,19-20,22-24H,11,32-33H2,1-6H3,(H,35,42)(H,34,37,38)/t16?,19-,20-,22?,23?,24?,30?/m0/s1 |
| InChIKey | FITWYHDVFZCUEQ-KDJZLCOOSA-N |
| XLogP | 2.08 |
| TPSA | 189.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|