C33H42O8SSi — CID 15538149
[(3aS,4S,6R,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15538149) has the molecular formula C33H42O8SSi and a molecular weight of 626.84 g/mol. Its IUPAC name is [(3aS,4S,6R,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aS,4S,6R,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15538149 |
| Molecular Formula | C33H42O8SSi |
| Molecular Weight | 626.84 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | [(3aS,4S,6R,6aR)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-methoxy-2,2-dimethyl-6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C33H42O8SSi/c1-24-18-20-25(21-19-24)42(34,35)37-22-33(29-28(30(36-7)41-33)39-32(5,6)40-29)23-38-43(31(2,3)4,26-14-10-8-11-15-26)27-16-12-9-13-17-27/h8-21,28-30H,22-23H2,1-7H3/t28-,29+,30-,33-/m1/s1 |
| InChIKey | OMBZVQRMHXUMAA-NDQSGYKOSA-N |
| XLogP | 4.54 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.84 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|