C30H38O8SSi — CID 15538151
[(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 15538151) has the molecular formula C30H38O8SSi and a molecular weight of 586.78 g/mol. Its IUPAC name is [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 15538151 |
| Molecular Formula | C30H38O8SSi |
| Molecular Weight | 586.78 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | [(2S,3S,4R,5R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydroxy-5-methoxyoxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CO[C@@H]1O[C@@](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)(COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C30H38O8SSi/c1-22-16-18-23(19-17-22)39(33,34)36-20-30(27(32)26(31)28(35-5)38-30)21-37-40(29(2,3)4,24-12-8-6-9-13-24)25-14-10-7-11-15-25/h6-19,26-28,31-32H,20-21H2,1-5H3/t26-,27+,28-,30-/m1/s1 |
| InChIKey | WFTRVXIOMWYCNT-JZGWFFLPSA-N |
| XLogP | 2.74 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|